3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid

C11H9NO3S — CID 131887333

IUPAC3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid
SMILESCOc1ccc2nc(C=CC(=O)O)sc2c1
InChIInChI=1S/C11H9NO3S/c1-15-7-2-3-8-9(6-7)16-10(12-8)4-5-11(13)14/h2-6H,1H3,(H,13,14)
InChIKeyGAKLBWMJWMSJOD-UHFFFAOYSA-N
MW235.26 g/mol
LogP2.40
Rot. Bonds3

About 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid

3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid (PubChem CID 131887333) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid
PubChem CID131887333
Molecular FormulaC11H9NO3S
Molecular Weight235.26 g/mol
Exact Mass235.03
IUPAC Name3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid
SMILESCOc1ccc2nc(C=CC(=O)O)sc2c1
InChIInChI=1S/C11H9NO3S/c1-15-7-2-3-8-9(6-7)16-10(12-8)4-5-11(13)14/h2-6H,1H3,(H,13,14)
InChIKeyGAKLBWMJWMSJOD-UHFFFAOYSA-N
XLogP2.40
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.26
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid?
The IUPAC name of 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid (CID 131887333) is 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid?
The canonical SMILES for 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid is COc1ccc2nc(C=CC(=O)O)sc2c1.
What is the InChIKey of 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid?
The InChIKey is GAKLBWMJWMSJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3S/c1-15-7-2-3-8-9(6-7)16-10(12-8)4-5-11(13)14/h2-6H,1H3,(H,13,14).
What are the key properties of 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid?
3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid has a molecular weight of 235.26 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methoxy-1,3-benzothiazol-2-yl)prop-2-enoic acid is sourced from PubChem (CID 131887333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).