C16H12ClNO3S — CID 135750005
3-chloro-5-[(E)-2-(6-methoxy-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol (PubChem CID 135750005) has the molecular formula C16H12ClNO3S and a molecular weight of 333.80 g/mol. Its IUPAC name is 3-chloro-5-[(E)-2-(6-methoxy-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol.
| Compound Name | 3-chloro-5-[(E)-2-(6-methoxy-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135750005 |
| Molecular Formula | C16H12ClNO3S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-chloro-5-[(E)-2-(6-methoxy-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol |
| SMILES | COc1ccc2nc(/C=C/c3cc(O)c(O)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C16H12ClNO3S/c1-21-10-3-4-12-14(8-10)22-15(18-12)5-2-9-6-11(17)16(20)13(19)7-9/h2-8,19-20H,1H3/b5-2+ |
| InChIKey | MGMXDXXDUQSHOZ-GORDUTHDSA-N |
| XLogP | 4.54 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|