C17H15NO3S — CID 135519915
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol (PubChem CID 135519915) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 135519915 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(/C=C/c2nc3ccccc3s2)cc(OC)c1O |
| InChI | InChI=1S/C17H15NO3S/c1-20-13-9-11(10-14(21-2)17(13)19)7-8-16-18-12-5-3-4-6-15(12)22-16/h3-10,19H,1-2H3/b8-7+ |
| InChIKey | UJBXCLPXVBYQIB-BQYQJAHWSA-N |
| XLogP | 4.19 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |