About 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol
2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol (PubChem CID 135752315) has the molecular formula C18H16BrNO2S
and a molecular weight of 390.30 g/mol. Its IUPAC name is 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol.
Molecular Properties
| Compound Name | 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol |
| PubChem CID | 135752315 |
| Molecular Formula | C18H16BrNO2S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol |
| SMILES | COc1cc(/C=C/c2nc3cc(C)c(C)cc3s2)cc(Br)c1O |
| InChI | InChI=1S/C18H16BrNO2S/c1-10-6-14-16(7-11(10)2)23-17(20-14)5-4-12-8-13(19)18(21)15(9-12)22-3/h4-9,21H,1-3H3/b5-4+ |
| InChIKey | RRYLZKCVTIOTRF-SNAWJCMRSA-N |
| XLogP | 5.56 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol?
The IUPAC name of 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol (CID 135752315) is 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol.
What is the SMILES notation for 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol?
The canonical SMILES for 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol is COc1cc(/C=C/c2nc3cc(C)c(C)cc3s2)cc(Br)c1O.
What is the InChIKey of 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol?
The InChIKey is RRYLZKCVTIOTRF-SNAWJCMRSA-N. The full InChI is InChI=1S/C18H16BrNO2S/c1-10-6-14-16(7-11(10)2)23-17(20-14)5-4-12-8-13(19)18(21)15(9-12)22-3/h4-9,21H,1-3H3/b5-4+.
What are the key properties of 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol?
2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol has a molecular weight of 390.30 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]-6-methoxyphenol is sourced from PubChem (CID 135752315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).