C17H15NOS — CID 6251725
3-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]phenol (PubChem CID 6251725) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]phenol.
| Compound Name | 3-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 6251725 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[(E)-2-(5,6-dimethyl-1,3-benzothiazol-2-yl)ethenyl]phenol |
| SMILES | Cc1cc2nc(/C=C/c3cccc(O)c3)sc2cc1C |
| InChI | InChI=1S/C17H15NOS/c1-11-8-15-16(9-12(11)2)20-17(18-15)7-6-13-4-3-5-14(19)10-13/h3-10,19H,1-2H3/b7-6+ |
| InChIKey | AMFQHMDQLXOHMO-VOTSOKGWSA-N |
| XLogP | 4.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |