C17H13ClN2O2S — CID 6183542
2-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]-5,6-dimethyl-1,3-benzothiazole (PubChem CID 6183542) has the molecular formula C17H13ClN2O2S and a molecular weight of 344.82 g/mol. Its IUPAC name is 2-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]-5,6-dimethyl-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]-5,6-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 6183542 |
| Molecular Formula | C17H13ClN2O2S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[(E)-2-(4-chloro-3-nitrophenyl)ethenyl]-5,6-dimethyl-1,3-benzothiazole |
| SMILES | Cc1cc2nc(/C=C/c3ccc(Cl)c([N+](=O)[O-])c3)sc2cc1C |
| InChI | InChI=1S/C17H13ClN2O2S/c1-10-7-14-16(8-11(10)2)23-17(19-14)6-4-12-3-5-13(18)15(9-12)20(21)22/h3-9H,1-2H3/b6-4+ |
| InChIKey | CSXCKPADPMSMPF-GQCTYLIASA-N |
| XLogP | 5.65 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|