C34H30N4O9S2 — CID 158890802
2,5-dimethyl-6-nitro-1,3-benzothiazole;4-hydroxy-3-methoxybenzaldehyde;2-methoxy-4-[(E)-2-(5-methyl-6-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol (PubChem CID 158890802) has the molecular formula C34H30N4O9S2 and a molecular weight of 702.77 g/mol. Its IUPAC name is 2,5-dimethyl-6-nitro-1,3-benzothiazole;4-hydroxy-3-methoxybenzaldehyde;2-methoxy-4-[(E)-2-(5-methyl-6-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol.
| Compound Name | 2,5-dimethyl-6-nitro-1,3-benzothiazole;4-hydroxy-3-methoxybenzaldehyde;2-methoxy-4-[(E)-2-(5-methyl-6-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 158890802 |
| Molecular Formula | C34H30N4O9S2 |
| Molecular Weight | 702.77 g/mol |
| Exact Mass | 702.15 |
| IUPAC Name | 2,5-dimethyl-6-nitro-1,3-benzothiazole;4-hydroxy-3-methoxybenzaldehyde;2-methoxy-4-[(E)-2-(5-methyl-6-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol |
| SMILES | COc1cc(/C=C/c2nc3cc(C)c([N+](=O)[O-])cc3s2)ccc1O.COc1cc(C=O)ccc1O.Cc1nc2cc(C)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C17H14N2O4S.C9H8N2O2S.C8H8O3/c1-10-7-12-16(9-13(10)19(21)22)24-17(18-12)6-4-11-3-5-14(20)15(8-11)23-2;1-5-3-7-9(14-6(2)10-7)4-8(5)11(12)13;1-11-8-4-6(5-9)2-3-7(8)10/h3-9,20H,1-2H3;3-4H,1-2H3;2-5,10H,1H3/b6-4+;; |
| InChIKey | JEFACFHXAMEBGS-SLNOCBGISA-N |
| XLogP | 8.43 |
| TPSA | 188.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|