C20H20N2O4S — CID 16959658
2-[(E)-2-(4-butoxy-3-methoxyphenyl)ethenyl]-5-nitro-1,3-benzothiazole (PubChem CID 16959658) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[(E)-2-(4-butoxy-3-methoxyphenyl)ethenyl]-5-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-butoxy-3-methoxyphenyl)ethenyl]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 16959658 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[(E)-2-(4-butoxy-3-methoxyphenyl)ethenyl]-5-nitro-1,3-benzothiazole |
| SMILES | CCCCOc1ccc(/C=C/c2nc3cc([N+](=O)[O-])ccc3s2)cc1OC |
| InChI | InChI=1S/C20H20N2O4S/c1-3-4-11-26-17-8-5-14(12-18(17)25-2)6-10-20-21-16-13-15(22(23)24)7-9-19(16)27-20/h5-10,12-13H,3-4,11H2,1-2H3/b10-6+ |
| InChIKey | BYGQVQIYVAHBGW-UXBLZVDNSA-N |
| XLogP | 5.56 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|