C23H16Cl2N2O4S — CID 3972990
2-[2-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-6-nitro-1,3-benzothiazole (PubChem CID 3972990) has the molecular formula C23H16Cl2N2O4S and a molecular weight of 487.36 g/mol. Its IUPAC name is 2-[2-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[2-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 3972990 |
| Molecular Formula | C23H16Cl2N2O4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-[2-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethenyl]-6-nitro-1,3-benzothiazole |
| SMILES | COc1cc(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl2N2O4S/c1-30-21-10-14(2-8-20(21)31-13-15-4-5-16(24)11-18(15)25)3-9-23-26-19-7-6-17(27(28)29)12-22(19)32-23/h2-12H,13H2,1H3 |
| InChIKey | QAWXPOITHNTLME-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|