C16H11ClN2O4S — CID 135677260
2-chloro-6-methoxy-4-[(E)-2-(5-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol (PubChem CID 135677260) has the molecular formula C16H11ClN2O4S and a molecular weight of 362.79 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[(E)-2-(5-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol.
| Compound Name | 2-chloro-6-methoxy-4-[(E)-2-(5-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 135677260 |
| Molecular Formula | C16H11ClN2O4S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-chloro-6-methoxy-4-[(E)-2-(5-nitro-1,3-benzothiazol-2-yl)ethenyl]phenol |
| SMILES | COc1cc(/C=C/c2nc3cc([N+](=O)[O-])ccc3s2)cc(Cl)c1O |
| InChI | InChI=1S/C16H11ClN2O4S/c1-23-13-7-9(6-11(17)16(13)20)2-5-15-18-12-8-10(19(21)22)3-4-14(12)24-15/h2-8,20H,1H3/b5-2+ |
| InChIKey | PLUQALIFBBAUCU-GORDUTHDSA-N |
| XLogP | 4.74 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|