C17H12F2N2O4S — CID 8861010
2-[(E)-2-[2-(difluoromethoxy)-3-methoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole (PubChem CID 8861010) has the molecular formula C17H12F2N2O4S and a molecular weight of 378.36 g/mol. Its IUPAC name is 2-[(E)-2-[2-(difluoromethoxy)-3-methoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-[2-(difluoromethoxy)-3-methoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 8861010 |
| Molecular Formula | C17H12F2N2O4S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[(E)-2-[2-(difluoromethoxy)-3-methoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole |
| SMILES | COc1cccc(/C=C/c2nc3cc([N+](=O)[O-])ccc3s2)c1OC(F)F |
| InChI | InChI=1S/C17H12F2N2O4S/c1-24-13-4-2-3-10(16(13)25-17(18)19)5-8-15-20-12-9-11(21(22)23)6-7-14(12)26-15/h2-9,17H,1H3/b8-5+ |
| InChIKey | AOHPBFSDKDFDHX-VMPITWQZSA-N |
| XLogP | 4.98 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|