C16H10F2N2O3S — CID 5038327
2-[2-[2-(difluoromethoxy)phenyl]ethenyl]-5-nitro-1,3-benzothiazole (PubChem CID 5038327) has the molecular formula C16H10F2N2O3S and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)phenyl]ethenyl]-5-nitro-1,3-benzothiazole.
| Compound Name | 2-[2-[2-(difluoromethoxy)phenyl]ethenyl]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 5038327 |
| Molecular Formula | C16H10F2N2O3S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)phenyl]ethenyl]-5-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2sc(C=Cc3ccccc3OC(F)F)nc2c1 |
| InChI | InChI=1S/C16H10F2N2O3S/c17-16(18)23-13-4-2-1-3-10(13)5-8-15-19-12-9-11(20(21)22)6-7-14(12)24-15/h1-9,16H |
| InChIKey | GFOUOOFCZHPCIR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|