C15H9ClN2O2S — CID 12816137
2-[(E)-2-(2-chloro-5-nitrophenyl)ethenyl]-1,3-benzothiazole (PubChem CID 12816137) has the molecular formula C15H9ClN2O2S and a molecular weight of 316.77 g/mol. Its IUPAC name is 2-[(E)-2-(2-chloro-5-nitrophenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(2-chloro-5-nitrophenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 12816137 |
| Molecular Formula | C15H9ClN2O2S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[(E)-2-(2-chloro-5-nitrophenyl)ethenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(/C=C/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H9ClN2O2S/c16-12-7-6-11(18(19)20)9-10(12)5-8-15-17-13-3-1-2-4-14(13)21-15/h1-9H/b8-5+ |
| InChIKey | NIRZBJVOQCJQFE-VMPITWQZSA-N |
| XLogP | 5.03 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|