C13H8N2O2S2 — CID 52683191
2-[(E)-2-(5-nitrothiophen-3-yl)ethenyl]-1,3-benzothiazole (PubChem CID 52683191) has the molecular formula C13H8N2O2S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(E)-2-(5-nitrothiophen-3-yl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(5-nitrothiophen-3-yl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 52683191 |
| Molecular Formula | C13H8N2O2S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-[(E)-2-(5-nitrothiophen-3-yl)ethenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1cc(/C=C/c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C13H8N2O2S2/c16-15(17)13-7-9(8-18-13)5-6-12-14-10-3-1-2-4-11(10)19-12/h1-8H/b6-5+ |
| InChIKey | AHJGSTNBLIYKGF-AATRIKPKSA-N |
| XLogP | 4.44 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|