C16H10N2O4S — CID 3302488
4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid (PubChem CID 3302488) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 3302488 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C16H10N2O4S/c19-16(20)11-4-1-10(2-5-11)3-8-15-17-13-7-6-12(18(21)22)9-14(13)23-15/h1-9H,(H,19,20) |
| InChIKey | HGYBTSUIRDTUSW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|