4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid

C16H10N2O4S — CID 3302488

IUPAC4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid
SMILESO=C(O)c1ccc(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)cc1
InChIInChI=1S/C16H10N2O4S/c19-16(20)11-4-1-10(2-5-11)3-8-15-17-13-7-6-12(18(21)22)9-14(13)23-15/h1-9H,(H,19,20)
InChIKeyHGYBTSUIRDTUSW-UHFFFAOYSA-N
MW326.33 g/mol
LogP4.07
Rot. Bonds4

About 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid

4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid (PubChem CID 3302488) has the molecular formula C16H10N2O4S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid
PubChem CID3302488
Molecular FormulaC16H10N2O4S
Molecular Weight326.33 g/mol
Exact Mass326.04
IUPAC Name4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid
SMILESO=C(O)c1ccc(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)cc1
InChIInChI=1S/C16H10N2O4S/c19-16(20)11-4-1-10(2-5-11)3-8-15-17-13-7-6-12(18(21)22)9-14(13)23-15/h1-9H,(H,19,20)
InChIKeyHGYBTSUIRDTUSW-UHFFFAOYSA-N
XLogP4.07
TPSA93.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.33
LogP ≤ 54.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid?
The IUPAC name of 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid (CID 3302488) is 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid.
What is the SMILES notation for 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid?
The canonical SMILES for 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid is O=C(O)c1ccc(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)cc1.
What is the InChIKey of 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid?
The InChIKey is HGYBTSUIRDTUSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4S/c19-16(20)11-4-1-10(2-5-11)3-8-15-17-13-7-6-12(18(21)22)9-14(13)23-15/h1-9H,(H,19,20).
What are the key properties of 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid?
4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid has a molecular weight of 326.33 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzoic acid is sourced from PubChem (CID 3302488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).