C13H7BrN2O2S2 — CID 27113727
2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-6-nitro-1,3-benzothiazole (PubChem CID 27113727) has the molecular formula C13H7BrN2O2S2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 27113727 |
| Molecular Formula | C13H7BrN2O2S2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 2-[(E)-2-(4-bromothiophen-2-yl)ethenyl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(/C=C/c3cc(Br)cs3)sc2c1 |
| InChI | InChI=1S/C13H7BrN2O2S2/c14-8-5-10(19-7-8)2-4-13-15-11-3-1-9(16(17)18)6-12(11)20-13/h1-7H/b4-2+ |
| InChIKey | HIKOHDSKLHVFBI-DUXPYHPUSA-N |
| XLogP | 5.20 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|