C15H9ClN2O4S — CID 135734491
3-chloro-5-[(E)-2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol (PubChem CID 135734491) has the molecular formula C15H9ClN2O4S and a molecular weight of 348.77 g/mol. Its IUPAC name is 3-chloro-5-[(E)-2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol.
| Compound Name | 3-chloro-5-[(E)-2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135734491 |
| Molecular Formula | C15H9ClN2O4S |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 3-chloro-5-[(E)-2-(6-nitro-1,3-benzothiazol-2-yl)ethenyl]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc2nc(/C=C/c3cc(O)c(O)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C15H9ClN2O4S/c16-10-5-8(6-12(19)15(10)20)1-4-14-17-11-3-2-9(18(21)22)7-13(11)23-14/h1-7,19-20H/b4-1+ |
| InChIKey | NRIRIALBMIUKRW-DAFODLJHSA-N |
| XLogP | 4.44 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|