C17H11ClN2O4S — CID 9186497
2-[(E)-2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-6-nitro-1,3-benzothiazole (PubChem CID 9186497) has the molecular formula C17H11ClN2O4S and a molecular weight of 374.81 g/mol. Its IUPAC name is 2-[(E)-2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 9186497 |
| Molecular Formula | C17H11ClN2O4S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 2-[(E)-2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethenyl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(/C=C/c3cc(Cl)c4c(c3)OCCO4)sc2c1 |
| InChI | InChI=1S/C17H11ClN2O4S/c18-12-7-10(8-14-17(12)24-6-5-23-14)1-4-16-19-13-3-2-11(20(21)22)9-15(13)25-16/h1-4,7-9H,5-6H2/b4-1+ |
| InChIKey | CNPGJXAZZCQFGP-DAFODLJHSA-N |
| XLogP | 4.80 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|