C16H12ClNO6S — CID 9036353
5-chloro-7-[(E)-2-(4-nitrophenyl)sulfonylethenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 9036353) has the molecular formula C16H12ClNO6S and a molecular weight of 381.79 g/mol. Its IUPAC name is 5-chloro-7-[(E)-2-(4-nitrophenyl)sulfonylethenyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-chloro-7-[(E)-2-(4-nitrophenyl)sulfonylethenyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 9036353 |
| Molecular Formula | C16H12ClNO6S |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 5-chloro-7-[(E)-2-(4-nitrophenyl)sulfonylethenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)/C=C/c2cc(Cl)c3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C16H12ClNO6S/c17-14-9-11(10-15-16(14)24-7-6-23-15)5-8-25(21,22)13-3-1-12(2-4-13)18(19)20/h1-5,8-10H,6-7H2/b8-5+ |
| InChIKey | FVTMVQIVPICHBC-VMPITWQZSA-N |
| XLogP | 3.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|