C17H14ClN3O5 — CID 9194702
N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 9194702) has the molecular formula C17H14ClN3O5 and a molecular weight of 375.77 g/mol. Its IUPAC name is N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9194702 |
| Molecular Formula | C17H14ClN3O5 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(N/N=C\c1cc(Cl)c2c(c1)OCCCO2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14ClN3O5/c18-14-8-11(9-15-16(14)26-7-1-6-25-15)10-19-20-17(22)12-2-4-13(5-3-12)21(23)24/h2-5,8-10H,1,6-7H2,(H,20,22)/b19-10- |
| InChIKey | HGNYUVXWHFNCDG-GRSHGNNSSA-N |
| XLogP | 3.17 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|