C14H9I2N3O4 — CID 136832455
N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-nitrobenzamide (PubChem CID 136832455) has the molecular formula C14H9I2N3O4 and a molecular weight of 537.05 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 136832455 |
| Molecular Formula | C14H9I2N3O4 |
| Molecular Weight | 537.05 g/mol |
| Exact Mass | 536.87 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3,5-diiodophenyl)methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(N/N=C\c1cc(I)c(O)c(I)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9I2N3O4/c15-11-5-8(6-12(16)13(11)20)7-17-18-14(21)9-1-3-10(4-2-9)19(22)23/h1-7,20H,(H,18,21)/b17-7- |
| InChIKey | LUMQHMKRKJSMCF-IDUWFGFVSA-N |
| XLogP | 3.27 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.05 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|