C22H27N3O4 — CID 139795331
3,5-ditert-butyl-4-hydroxy-N-[(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 139795331) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-[(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-[(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 139795331 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-[(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)NN=Cc2ccc([N+](=O)[O-])cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27N3O4/c1-21(2,3)17-11-15(12-18(19(17)26)22(4,5)6)20(27)24-23-13-14-7-9-16(10-8-14)25(28)29/h7-13,26H,1-6H3,(H,24,27) |
| InChIKey | CMUBQTXJDIUCDD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|