C20H27N3O2 — CID 139795288
3,5-ditert-butyl-4-hydroxy-N-(1H-pyrrol-2-ylmethylideneamino)benzamide (PubChem CID 139795288) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-(1H-pyrrol-2-ylmethylideneamino)benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-(1H-pyrrol-2-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 139795288 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-(1H-pyrrol-2-ylmethylideneamino)benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)NN=Cc2ccc[nH]2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H27N3O2/c1-19(2,3)15-10-13(11-16(17(15)24)20(4,5)6)18(25)23-22-12-14-8-7-9-21-14/h7-12,21,24H,1-6H3,(H,23,25) |
| InChIKey | SDDBYBJWXATXJO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|