C30H44N2O3 — CID 135437571
3,5-ditert-butyl-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-4-hydroxybenzamide (PubChem CID 135437571) has the molecular formula C30H44N2O3 and a molecular weight of 480.69 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 135437571 |
| Molecular Formula | C30H44N2O3 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.34 |
| IUPAC Name | 3,5-ditert-butyl-N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-4-hydroxybenzamide |
| SMILES | CC(C)(C)c1cc(/C=N/NC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H44N2O3/c1-27(2,3)20-13-18(14-21(24(20)33)28(4,5)6)17-31-32-26(35)19-15-22(29(7,8)9)25(34)23(16-19)30(10,11)12/h13-17,33-34H,1-12H3,(H,32,35)/b31-17+ |
| InChIKey | JCMSLAUQJMAROW-KBVAKVRCSA-N |
| XLogP | 7.05 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|