C18H34N2O — CID 172972510
2,6-ditert-butyl-4-[(E)-(methylhydrazinylidene)methyl]phenol;methane (PubChem CID 172972510) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-(methylhydrazinylidene)methyl]phenol;methane.
| Compound Name | 2,6-ditert-butyl-4-[(E)-(methylhydrazinylidene)methyl]phenol;methane |
|---|---|
| PubChem CID | 172972510 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-(methylhydrazinylidene)methyl]phenol;methane |
| SMILES | C.C.CN/N=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H26N2O.2CH4/c1-15(2,3)12-8-11(10-18-17-7)9-13(14(12)19)16(4,5)6;;/h8-10,17,19H,1-7H3;2*1H4/b18-10+;; |
| InChIKey | UXBHXQNJYKZFNB-LCCCTGDHSA-N |
| XLogP | 4.81 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|