C24H29N3O — CID 136690371
2,6-ditert-butyl-4-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol (PubChem CID 136690371) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136690371 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2,6-ditert-butyl-4-[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N\Nc2ccc3ccccc3n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H29N3O/c1-23(2,3)18-13-16(14-19(22(18)28)24(4,5)6)15-25-27-21-12-11-17-9-7-8-10-20(17)26-21/h7-15,28H,1-6H3,(H,26,27)/b25-15- |
| InChIKey | CWBUZHSSXNAQDS-MYYYXRDXSA-N |
| XLogP | 5.98 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|