C16H12Br2ClN3O — CID 163327922
2,6-dibromo-4-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenol;hydrochloride (PubChem CID 163327922) has the molecular formula C16H12Br2ClN3O and a molecular weight of 457.55 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenol;hydrochloride.
| Compound Name | 2,6-dibromo-4-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 163327922 |
| Molecular Formula | C16H12Br2ClN3O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 454.90 |
| IUPAC Name | 2,6-dibromo-4-[(E)-(quinolin-2-ylhydrazinylidene)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1c(Br)cc(/C=N/Nc2ccc3ccccc3n2)cc1Br |
| InChI | InChI=1S/C16H11Br2N3O.ClH/c17-12-7-10(8-13(18)16(12)22)9-19-21-15-6-5-11-3-1-2-4-14(11)20-15;/h1-9,22H,(H,20,21);1H/b19-9+; |
| InChIKey | LYORJZHNVOOIQT-MYHMWQFYSA-N |
| XLogP | 5.33 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|