C13H12Br2N4O — CID 136803392
2,6-dibromo-4-[(Z)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136803392) has the molecular formula C13H12Br2N4O and a molecular weight of 400.07 g/mol. Its IUPAC name is 2,6-dibromo-4-[(Z)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(Z)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136803392 |
| Molecular Formula | C13H12Br2N4O |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | 2,6-dibromo-4-[(Z)-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(C)nc(N/N=C\c2cc(Br)c(O)c(Br)c2)n1 |
| InChI | InChI=1S/C13H12Br2N4O/c1-7-3-8(2)18-13(17-7)19-16-6-9-4-10(14)12(20)11(15)5-9/h3-6,20H,1-2H3,(H,17,18,19)/b16-6- |
| InChIKey | GPSAZPLLFMJFSF-SOFYXZRVSA-N |
| XLogP | 3.77 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|