C15H17BrN4O2 — CID 9013436
N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 9013436) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 9013436 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | COc1cc(Br)c(/C=N\Nc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C15H17BrN4O2/c1-9-5-10(2)19-15(18-9)20-17-8-11-6-13(21-3)14(22-4)7-12(11)16/h5-8H,1-4H3,(H,18,19,20)/b17-8- |
| InChIKey | CPYFYNAHQVJPSP-IUXPMGMMSA-N |
| XLogP | 3.32 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|