C20H18BrN5O4 — CID 45037629
[5-bromo-2-methoxy-4-[(E)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 45037629) has the molecular formula C20H18BrN5O4 and a molecular weight of 472.30 g/mol. Its IUPAC name is [5-bromo-2-methoxy-4-[(E)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [5-bromo-2-methoxy-4-[(E)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 45037629 |
| Molecular Formula | C20H18BrN5O4 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [5-bromo-2-methoxy-4-[(E)-[[5-(2-methoxyphenyl)-1,2,4-triazin-3-yl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N/Nc2nncc(-c3ccccc3OC)n2)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C20H18BrN5O4/c1-12(27)30-19-9-15(21)13(8-18(19)29-3)10-22-25-20-24-16(11-23-26-20)14-6-4-5-7-17(14)28-2/h4-11H,1-3H3,(H,24,25,26)/b22-10+ |
| InChIKey | RGCHSLNUOXUFMB-LSHDLFTRSA-N |
| XLogP | 3.69 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|