C16H17BrN2O2 — CID 9014557
N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-methylaniline (PubChem CID 9014557) has the molecular formula C16H17BrN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-methylaniline.
| Compound Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-methylaniline |
|---|---|
| PubChem CID | 9014557 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-methylaniline |
| SMILES | COc1cc(Br)c(/C=N\Nc2ccccc2C)cc1OC |
| InChI | InChI=1S/C16H17BrN2O2/c1-11-6-4-5-7-14(11)19-18-10-12-8-15(20-2)16(21-3)9-13(12)17/h4-10,19H,1-3H3/b18-10- |
| InChIKey | ANPZKTQFAASJPL-ZDLGFXPLSA-N |
| XLogP | 4.22 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|