C23H21BrClN3O3 — CID 3554168
1-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3554168) has the molecular formula C23H21BrClN3O3 and a molecular weight of 502.80 g/mol. Its IUPAC name is 1-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3554168 |
| Molecular Formula | C23H21BrClN3O3 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 1-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | COc1cc(C=NNC(=O)Nc2ccccc2C)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H21BrClN3O3/c1-15-7-3-6-10-20(15)27-23(29)28-26-13-17-11-21(30-2)22(12-18(17)24)31-14-16-8-4-5-9-19(16)25/h3-13H,14H2,1-2H3,(H2,27,28,29) |
| InChIKey | NCRLLNUEDPVPDQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|