C16H15BrFN3O3 — CID 126087766
[(Z)-[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea (PubChem CID 126087766) has the molecular formula C16H15BrFN3O3 and a molecular weight of 396.22 g/mol. Its IUPAC name is [(Z)-[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea.
| Compound Name | [(Z)-[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 126087766 |
| Molecular Formula | C16H15BrFN3O3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [(Z)-[2-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]urea |
| SMILES | COc1cc(/C=N\NC(N)=O)c(Br)cc1OCc1ccccc1F |
| InChI | InChI=1S/C16H15BrFN3O3/c1-23-14-6-11(8-20-21-16(19)22)12(17)7-15(14)24-9-10-4-2-3-5-13(10)18/h2-8H,9H2,1H3,(H3,19,21,22)/b20-8- |
| InChIKey | OYIJHLYQTUXOMN-ZBKNUEDVSA-N |
| XLogP | 3.18 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|