C26H21BrClN3O3 — CID 3819550
N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-pyrrol-1-ylbenzamide (PubChem CID 3819550) has the molecular formula C26H21BrClN3O3 and a molecular weight of 538.83 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-pyrrol-1-ylbenzamide.
| Compound Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 3819550 |
| Molecular Formula | C26H21BrClN3O3 |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | N-[[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-pyrrol-1-ylbenzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2-n2cccc2)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H21BrClN3O3/c1-33-24-14-19(21(27)15-25(24)34-17-18-8-2-4-10-22(18)28)16-29-30-26(32)20-9-3-5-11-23(20)31-12-6-7-13-31/h2-16H,17H2,1H3,(H,30,32) |
| InChIKey | YQYOVBIWCIGPDR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|