C15H14BrNO2 — CID 13212556
1-(2-bromo-4,5-dimethoxyphenyl)-N-phenylmethanimine (PubChem CID 13212556) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N-phenylmethanimine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 13212556 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-phenylmethanimine |
| SMILES | COc1cc(Br)c(/C=N/c2ccccc2)cc1OC |
| InChI | InChI=1S/C15H14BrNO2/c1-18-14-8-11(13(16)9-15(14)19-2)10-17-12-6-4-3-5-7-12/h3-10H,1-2H3/b17-10+ |
| InChIKey | CDXQOERZWIVXOC-LICLKQGHSA-N |
| XLogP | 4.22 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|