C22H18BrNO3 — CID 1381574
[4-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-phenylmethanone (PubChem CID 1381574) has the molecular formula C22H18BrNO3 and a molecular weight of 424.29 g/mol. Its IUPAC name is [4-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-phenylmethanone.
| Compound Name | [4-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 1381574 |
| Molecular Formula | C22H18BrNO3 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [4-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]phenyl]-phenylmethanone |
| SMILES | COc1cc(OC)c(/C=N/c2ccc(C(=O)c3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C22H18BrNO3/c1-26-20-13-21(27-2)19(23)12-17(20)14-24-18-10-8-16(9-11-18)22(25)15-6-4-3-5-7-15/h3-14H,1-2H3/b24-14+ |
| InChIKey | PJGMCFGVZIELIU-ZVHZXABRSA-N |
| XLogP | 5.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|