C23H19BrClN3O4 — CID 171134368
N-[4-[[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-chlorobenzamide (PubChem CID 171134368) has the molecular formula C23H19BrClN3O4 and a molecular weight of 516.78 g/mol. Its IUPAC name is N-[4-[[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-chlorobenzamide.
| Compound Name | N-[4-[[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 171134368 |
| Molecular Formula | C23H19BrClN3O4 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | N-[4-[[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]-2-chlorobenzamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)cc1Br |
| InChI | InChI=1S/C23H19BrClN3O4/c1-31-20-12-21(32-2)18(24)11-15(20)13-26-28-22(29)14-7-9-16(10-8-14)27-23(30)17-5-3-4-6-19(17)25/h3-13H,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | YGGZJLBJOKPFFJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|