C22H16BrCl2N3O3 — CID 3473423
2-bromo-N-[4-[[(3,5-dichloro-2-methoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 3473423) has the molecular formula C22H16BrCl2N3O3 and a molecular weight of 521.20 g/mol. Its IUPAC name is 2-bromo-N-[4-[[(3,5-dichloro-2-methoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[4-[[(3,5-dichloro-2-methoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3473423 |
| Molecular Formula | C22H16BrCl2N3O3 |
| Molecular Weight | 521.20 g/mol |
| Exact Mass | 518.98 |
| IUPAC Name | 2-bromo-N-[4-[[(3,5-dichloro-2-methoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=NNC(=O)c1ccc(NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C22H16BrCl2N3O3/c1-31-20-14(10-15(24)11-19(20)25)12-26-28-21(29)13-6-8-16(9-7-13)27-22(30)17-4-2-3-5-18(17)23/h2-12H,1H3,(H,27,30)(H,28,29) |
| InChIKey | OPEMJVZYNJBKEU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.20 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|