C21H16BrN3O3 — CID 135510989
2-bromo-N-[4-[[(E)-(4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 135510989) has the molecular formula C21H16BrN3O3 and a molecular weight of 438.28 g/mol. Its IUPAC name is 2-bromo-N-[4-[[(E)-(4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[4-[[(E)-(4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 135510989 |
| Molecular Formula | C21H16BrN3O3 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-bromo-N-[4-[[(E)-(4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)c1ccc(NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C21H16BrN3O3/c22-19-4-2-1-3-18(19)21(28)24-16-9-7-15(8-10-16)20(27)25-23-13-14-5-11-17(26)12-6-14/h1-13,26H,(H,24,28)(H,25,27)/b23-13+ |
| InChIKey | CCAMNSFQNUUGRB-YDZHTSKRSA-N |
| XLogP | 4.17 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|