C21H15Br2N3O3 — CID 135419971
2-bromo-N-[4-[[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 135419971) has the molecular formula C21H15Br2N3O3 and a molecular weight of 517.18 g/mol. Its IUPAC name is 2-bromo-N-[4-[[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[4-[[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 135419971 |
| Molecular Formula | C21H15Br2N3O3 |
| Molecular Weight | 517.18 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | 2-bromo-N-[4-[[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(N/N=C/c1ccc(O)c(Br)c1)c1ccc(NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C21H15Br2N3O3/c22-17-4-2-1-3-16(17)21(29)25-15-8-6-14(7-9-15)20(28)26-24-12-13-5-10-19(27)18(23)11-13/h1-12,27H,(H,25,29)(H,26,28)/b24-12+ |
| InChIKey | GWZPQSKUVJRQGX-WYMPLXKRSA-N |
| XLogP | 4.93 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|