C22H17ClN4O6 — CID 3923185
2-chloro-N-[4-[[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 3923185) has the molecular formula C22H17ClN4O6 and a molecular weight of 468.85 g/mol. Its IUPAC name is 2-chloro-N-[4-[[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3923185 |
| Molecular Formula | C22H17ClN4O6 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-chloro-N-[4-[[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1cc([N+](=O)[O-])cc(C=NNC(=O)c2ccc(NC(=O)c3ccccc3Cl)cc2)c1O |
| InChI | InChI=1S/C22H17ClN4O6/c1-33-19-11-16(27(31)32)10-14(20(19)28)12-24-26-21(29)13-6-8-15(9-7-13)25-22(30)17-4-2-3-5-18(17)23/h2-12,28H,1H3,(H,25,30)(H,26,29) |
| InChIKey | AUTFNAXIKIBVRB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|