C15H12N4O7 — CID 136712197
N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide (PubChem CID 136712197) has the molecular formula C15H12N4O7 and a molecular weight of 360.28 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 136712197 |
| Molecular Formula | C15H12N4O7 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C15H12N4O7/c1-26-13-7-12(19(24)25)6-10(14(13)20)8-16-17-15(21)9-2-4-11(5-3-9)18(22)23/h2-8,20H,1H3,(H,17,21)/b16-8+ |
| InChIKey | APWMIBJAENJRKB-LZYBPNLTSA-N |
| XLogP | 1.98 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|