C14H14N4O5S — CID 136733452
N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 136733452) has the molecular formula C14H14N4O5S and a molecular weight of 350.36 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 136733452 |
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/NC(=O)c2sc(C)nc2C)c1O |
| InChI | InChI=1S/C14H14N4O5S/c1-7-13(24-8(2)16-7)14(20)17-15-6-9-4-10(18(21)22)5-11(23-3)12(9)19/h4-6,19H,1-3H3,(H,17,20)/b15-6+ |
| InChIKey | CKBOKMZNKWKONO-GIDUJCDVSA-N |
| XLogP | 2.15 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|