C24H22Br2N2O4 — CID 101215350
1-(2-bromo-4,5-dimethoxyphenyl)-N-[4-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]phenyl]methanimine (PubChem CID 101215350) has the molecular formula C24H22Br2N2O4 and a molecular weight of 562.26 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N-[4-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]phenyl]methanimine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-[4-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]phenyl]methanimine |
|---|---|
| PubChem CID | 101215350 |
| Molecular Formula | C24H22Br2N2O4 |
| Molecular Weight | 562.26 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-[4-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]phenyl]methanimine |
| SMILES | COc1cc(Br)c(/C=N/c2ccc(/N=C/c3cc(OC)c(OC)cc3Br)cc2)cc1OC |
| InChI | InChI=1S/C24H22Br2N2O4/c1-29-21-9-15(19(25)11-23(21)31-3)13-27-17-5-7-18(8-6-17)28-14-16-10-22(30-2)24(32-4)12-20(16)26/h5-14H,1-4H3/b27-13+,28-14+ |
| InChIKey | FXLHQGBODRVBCD-OCHFTUDZSA-N |
| XLogP | 6.75 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.26 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|