C21H18BrNO3 — CID 4506437
1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)methanimine (PubChem CID 4506437) has the molecular formula C21H18BrNO3 and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4506437 |
| Molecular Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-(5-bromo-2,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(/C=N/c2ccc(Oc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C21H18BrNO3/c1-24-20-13-21(25-2)19(22)12-15(20)14-23-16-8-10-18(11-9-16)26-17-6-4-3-5-7-17/h3-14H,1-2H3/b23-14+ |
| InChIKey | AGOWORZUIQFHRI-OEAKJJBVSA-N |
| XLogP | 6.01 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|