C22H21NO4 — CID 4505600
N-(4-phenoxyphenyl)-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 4505600) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | N-(4-phenoxyphenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4505600 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-(4-phenoxyphenyl)-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO4/c1-24-20-13-16(14-21(25-2)22(20)26-3)15-23-17-9-11-19(12-10-17)27-18-7-5-4-6-8-18/h4-15H,1-3H3/b23-15+ |
| InChIKey | ILNMMPZYEPHJJO-HZHRSRAPSA-N |
| XLogP | 5.26 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|