C21H17Br2NO2 — CID 126219590
1-(3,5-dibromo-4-ethoxyphenyl)-N-(4-phenoxyphenyl)methanimine (PubChem CID 126219590) has the molecular formula C21H17Br2NO2 and a molecular weight of 475.18 g/mol. Its IUPAC name is 1-(3,5-dibromo-4-ethoxyphenyl)-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-(3,5-dibromo-4-ethoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126219590 |
| Molecular Formula | C21H17Br2NO2 |
| Molecular Weight | 475.18 g/mol |
| Exact Mass | 472.96 |
| IUPAC Name | 1-(3,5-dibromo-4-ethoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
| SMILES | CCOc1c(Br)cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C21H17Br2NO2/c1-2-25-21-19(22)12-15(13-20(21)23)14-24-16-8-10-18(11-9-16)26-17-6-4-3-5-7-17/h3-14H,2H2,1H3/b24-14+ |
| InChIKey | UDGISRAFSHURAJ-ZVHZXABRSA-N |
| XLogP | 7.15 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.18 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|