C24H24INO3 — CID 126223775
1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-phenoxyphenyl)methanimine (PubChem CID 126223775) has the molecular formula C24H24INO3 and a molecular weight of 501.36 g/mol. Its IUPAC name is 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126223775 |
| Molecular Formula | C24H24INO3 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-phenoxyphenyl)methanimine |
| SMILES | CCCOc1c(I)cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc1OCC |
| InChI | InChI=1S/C24H24INO3/c1-3-14-28-24-22(25)15-18(16-23(24)27-4-2)17-26-19-10-12-21(13-11-19)29-20-8-6-5-7-9-20/h5-13,15-17H,3-4,14H2,1-2H3/b26-17+ |
| InChIKey | QHHANVHDDCAJKG-YZSQISJMSA-N |
| XLogP | 7.02 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|