C20H24INO3 — CID 126214958
1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-ethoxyphenyl)methanimine (PubChem CID 126214958) has the molecular formula C20H24INO3 and a molecular weight of 453.32 g/mol. Its IUPAC name is 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126214958 |
| Molecular Formula | C20H24INO3 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-(3-ethoxy-5-iodo-4-propoxyphenyl)-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCCOc1c(I)cc(/C=N/c2ccc(OCC)cc2)cc1OCC |
| InChI | InChI=1S/C20H24INO3/c1-4-11-25-20-18(21)12-15(13-19(20)24-6-3)14-22-16-7-9-17(10-8-16)23-5-2/h7-10,12-14H,4-6,11H2,1-3H3/b22-14+ |
| InChIKey | BXCLYCMOBCBEQK-HYARGMPZSA-N |
| XLogP | 5.63 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|