C19H18INO3 — CID 126215520
N-(4-ethoxyphenyl)-1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methanimine (PubChem CID 126215520) has the molecular formula C19H18INO3 and a molecular weight of 435.26 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methanimine.
| Compound Name | N-(4-ethoxyphenyl)-1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126215520 |
| Molecular Formula | C19H18INO3 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-(4-ethoxyphenyl)-1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)methanimine |
| SMILES | C#CCOc1c(I)cc(/C=N/c2ccc(OCC)cc2)cc1OC |
| InChI | InChI=1S/C19H18INO3/c1-4-10-24-19-17(20)11-14(12-18(19)22-3)13-21-15-6-8-16(9-7-15)23-5-2/h1,6-9,11-13H,5,10H2,2-3H3/b21-13+ |
| InChIKey | FMYSCEZARMCFJB-FYJGNVAPSA-N |
| XLogP | 4.46 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|